Difference between revisions of "AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite KYNURENATE == * common-name: ** kynurenate * molecular-weight: ** 187.154 * inchi-key: ** hczhheifkropdy-uhfffaoysa-l * smiles: ** c1(c=c...")
 
(Created page with "Category:metabolite == Metabolite LysW-L-glutamate-5-semialdehyde == * common-name: ** a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(l-glutamate 5-semialdehyde-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite KYNURENATE ==
+
== Metabolite LysW-L-glutamate-5-semialdehyde ==
 
* common-name:
 
* common-name:
** kynurenate
+
** a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(l-glutamate 5-semialdehyde-2-yl)-l-glutamate
* molecular-weight:
 
** 187.154
 
* inchi-key:
 
** hczhheifkropdy-uhfffaoysa-l
 
* smiles:
 
** c1(c=c2(c(=cc=1)n=c(c(=o)[o-])c=c([o-])2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-15007]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10720]]
+
* [[RXN-15006]]
 +
* [[RXN-15007]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kynurenate}}
+
{{#set: common-name=a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(l-glutamate 5-semialdehyde-2-yl)-l-glutamate}}
{{#set: molecular-weight=187.154}}
 
{{#set: inchi-key=inchikey=hczhheifkropdy-uhfffaoysa-l}}
 

Revision as of 17:51, 13 January 2021

Metabolite LysW-L-glutamate-5-semialdehyde

  • common-name:
    • a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(l-glutamate 5-semialdehyde-2-yl)-l-glutamate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [lysine-biosynthesis-protein lysw]-c-terminal-γ-(l-glutamate 5-semialdehyde-2-yl)-l-glutamate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.