Difference between revisions of "All-holo-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite METHACRYLYL-COA == * common-name: ** methylacrylyl-coa * molecular-weight: ** 831.577 * inchi-key: ** npalueycdzwbov-ndzskpawsa-j * smile...")
 
(Created page with "Category:metabolite == Metabolite CPD-15163 == * common-name: ** prop-2-ynal * molecular-weight: ** 54.048 * inchi-key: ** ijnjlgftsiahea-uhfffaoysa-n * smiles: ** c#cc=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite METHACRYLYL-COA ==
+
== Metabolite CPD-15163 ==
 
* common-name:
 
* common-name:
** methylacrylyl-coa
+
** prop-2-ynal
 
* molecular-weight:
 
* molecular-weight:
** 831.577
+
** 54.048
 
* inchi-key:
 
* inchi-key:
** npalueycdzwbov-ndzskpawsa-j
+
** ijnjlgftsiahea-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c=c(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** c#cc=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
+
* [[RXN-14224]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[MEPROPCOA-FAD-RXN]]
 
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=methylacrylyl-coa}}
+
{{#set: common-name=prop-2-ynal}}
{{#set: molecular-weight=831.577}}
+
{{#set: molecular-weight=54.048}}
{{#set: inchi-key=inchikey=npalueycdzwbov-ndzskpawsa-j}}
+
{{#set: inchi-key=inchikey=ijnjlgftsiahea-uhfffaoysa-n}}

Revision as of 17:53, 13 January 2021

Metabolite CPD-15163

  • common-name:
    • prop-2-ynal
  • molecular-weight:
    • 54.048
  • inchi-key:
    • ijnjlgftsiahea-uhfffaoysa-n
  • smiles:
    • c#cc=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality