Difference between revisions of "3-UREIDO-PROPIONATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-METHYL-CROTONYL-COA == * common-name: ** 3-methylcrotonyl-coa * molecular-weight: ** 845.604 * inchi-key: ** bxipalatiynhjn-zmhdxicwsa-...")
 
(Created page with "Category:metabolite == Metabolite 4-IMIDAZOLEACETATE == * common-name: ** 4-imidazoleacetate * molecular-weight: ** 125.107 * inchi-key: ** prjknhomhkjcej-uhfffaoysa-m * s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-METHYL-CROTONYL-COA ==
+
== Metabolite 4-IMIDAZOLEACETATE ==
 
* common-name:
 
* common-name:
** 3-methylcrotonyl-coa
+
** 4-imidazoleacetate
 
* molecular-weight:
 
* molecular-weight:
** 845.604
+
** 125.107
 
* inchi-key:
 
* inchi-key:
** bxipalatiynhjn-zmhdxicwsa-j
+
** prjknhomhkjcej-uhfffaoysa-m
 
* smiles:
 
* smiles:
** cc(=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])c
+
** c1(nc=c(cc(=o)[o-])n=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 
* [[RXN-14264]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11921]]
+
* [[RXN-10089]]
* [[RXN-14264]]
 
* [[RXN0-2301]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-methylcrotonyl-coa}}
+
{{#set: common-name=4-imidazoleacetate}}
{{#set: molecular-weight=845.604}}
+
{{#set: molecular-weight=125.107}}
{{#set: inchi-key=inchikey=bxipalatiynhjn-zmhdxicwsa-j}}
+
{{#set: inchi-key=inchikey=prjknhomhkjcej-uhfffaoysa-m}}

Revision as of 17:53, 13 January 2021

Metabolite 4-IMIDAZOLEACETATE

  • common-name:
    • 4-imidazoleacetate
  • molecular-weight:
    • 125.107
  • inchi-key:
    • prjknhomhkjcej-uhfffaoysa-m
  • smiles:
    • c1(nc=c(cc(=o)[o-])n=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality