Difference between revisions of "ACETYLSERINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * molecular-weight: ** 393.372 * inchi-key: ** drkqfnyksnwotc-rngzqalnsa-m...") |
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * molecular-weight: ** 170.058 * inchi-key: ** awucvroldviajx-gsvougtgsa-l * smi...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLYCEROL-3P == |
* common-name: | * common-name: | ||
− | ** | + | ** sn-glycerol 3-phosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 170.058 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** awucvroldviajx-gsvougtgsa-l |
* smiles: | * smiles: | ||
− | ** | + | ** c(op([o-])(=o)[o-])c(o)co |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[GLYCEROL-KIN-RXN]] | ||
+ | * [[PHOSPHAGLYPSYN-RXN]] | ||
+ | * [[RXN-1381]] | ||
+ | * [[RXN-15045]] | ||
+ | * [[RXN0-5260]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[1.1.1.8-RXN]] |
+ | * [[GLYC3PDEHYDROGBIOSYN-RXN]] | ||
+ | * [[GLYCEROL-KIN-RXN]] | ||
+ | * [[GLYCPDIESTER-RXN]] | ||
+ | * [[RXN-14073]] | ||
+ | * [[RXN-14136]] | ||
+ | * [[RXN-14160]] | ||
+ | * [[RXN0-5257]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=sn-glycerol 3-phosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.058}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}} |
Revision as of 17:53, 13 January 2021
Contents
Metabolite GLYCEROL-3P
- common-name:
- sn-glycerol 3-phosphate
- molecular-weight:
- 170.058
- inchi-key:
- awucvroldviajx-gsvougtgsa-l
- smiles:
- c(op([o-])(=o)[o-])c(o)co
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- 1.1.1.8-RXN
- GLYC3PDEHYDROGBIOSYN-RXN
- GLYCEROL-KIN-RXN
- GLYCPDIESTER-RXN
- RXN-14073
- RXN-14136
- RXN-14160
- RXN0-5257