Difference between revisions of "ACETYLSERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12016 == * common-name: ** n-acetyl-serotonin glucuronide * molecular-weight: ** 393.372 * inchi-key: ** drkqfnyksnwotc-rngzqalnsa-m...")
 
(Created page with "Category:metabolite == Metabolite GLYCEROL-3P == * common-name: ** sn-glycerol 3-phosphate * molecular-weight: ** 170.058 * inchi-key: ** awucvroldviajx-gsvougtgsa-l * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12016 ==
+
== Metabolite GLYCEROL-3P ==
 
* common-name:
 
* common-name:
** n-acetyl-serotonin glucuronide
+
** sn-glycerol 3-phosphate
 
* molecular-weight:
 
* molecular-weight:
** 393.372
+
** 170.058
 
* inchi-key:
 
* inchi-key:
** drkqfnyksnwotc-rngzqalnsa-m
+
** awucvroldviajx-gsvougtgsa-l
 
* smiles:
 
* smiles:
** cc(=o)nccc2(=cnc3(=cc=c(oc1(oc(c([o-])=o)c(o)c(o)c(o)1))c=c23))
+
** c(op([o-])(=o)[o-])c(o)co
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[PHOSPHAGLYPSYN-RXN]]
 +
* [[RXN-1381]]
 +
* [[RXN-15045]]
 +
* [[RXN0-5260]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11060]]
+
* [[1.1.1.8-RXN]]
 +
* [[GLYC3PDEHYDROGBIOSYN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GLYCPDIESTER-RXN]]
 +
* [[RXN-14073]]
 +
* [[RXN-14136]]
 +
* [[RXN-14160]]
 +
* [[RXN0-5257]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-serotonin glucuronide}}
+
{{#set: common-name=sn-glycerol 3-phosphate}}
{{#set: molecular-weight=393.372}}
+
{{#set: molecular-weight=170.058}}
{{#set: inchi-key=inchikey=drkqfnyksnwotc-rngzqalnsa-m}}
+
{{#set: inchi-key=inchikey=awucvroldviajx-gsvougtgsa-l}}

Revision as of 17:53, 13 January 2021

Metabolite GLYCEROL-3P

  • common-name:
    • sn-glycerol 3-phosphate
  • molecular-weight:
    • 170.058
  • inchi-key:
    • awucvroldviajx-gsvougtgsa-l
  • smiles:
    • c(op([o-])(=o)[o-])c(o)co

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality