Difference between revisions of "5-METHYLTHIOADENOSINE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4101 == * common-name: ** 24-methylidenelophenol * molecular-weight: ** 412.698 * inchi-key: ** rsmkyrdccsnyfm-aagdoflisa-n * smiles:...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXY-TRYPTOPHAN == * common-name: ** 5-hydroxy-l-tryptophan * molecular-weight: ** 220.227 * inchi-key: ** ldcyzajdbxycgn-vifpvbqesa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXY-TRYPTOPHAN == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxy-l-tryptophan |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 220.227 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ldcyzajdbxycgn-vifpvbqesa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+])) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3DJ-170]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxy-l-tryptophan}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=220.227}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ldcyzajdbxycgn-vifpvbqesa-n}} |
Revision as of 17:53, 13 January 2021
Contents
Metabolite 5-HYDROXY-TRYPTOPHAN
- common-name:
- 5-hydroxy-l-tryptophan
- molecular-weight:
- 220.227
- inchi-key:
- ldcyzajdbxycgn-vifpvbqesa-n
- smiles:
- c2(nc1(c=cc(o)=cc=1c=2cc(c(=o)[o-])[n+]))
