Difference between revisions of "3-KETOACYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MN+2 == * common-name: ** mn2+ * molecular-weight: ** 54.938 * inchi-key: ** waemqwokjmhjla-uhfffaoysa-n * smiles: ** [mn++] == Reaction(...") |
(Created page with "Category:metabolite == Metabolite CPD-19726 == * common-name: ** (4s)-2,3-dehydro-leucocyanidin * molecular-weight: ** 304.256 * inchi-key: ** yaagnrwejszflv-zdusscgksa-n...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-19726 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (4s)-2,3-dehydro-leucocyanidin |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 304.256 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** yaagnrwejszflv-zdusscgksa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-602]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(4s)-2,3-dehydro-leucocyanidin}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=304.256}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yaagnrwejszflv-zdusscgksa-n}} |
Revision as of 17:54, 13 January 2021
Contents
Metabolite CPD-19726
- common-name:
- (4s)-2,3-dehydro-leucocyanidin
- molecular-weight:
- 304.256
- inchi-key:
- yaagnrwejszflv-zdusscgksa-n
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c=2o)o)o)o)))=cc(o)=c(c=3)o)
