Difference between revisions of "AN-ALPHA-L-FUCOSIDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP == * common-name: ** udp * molecular-weight: ** 401.14 * inchi-key: ** xcctyiawtasojw-xvfcmesisa-k * smiles: ** c(op(=o)([o-])op(=o)(...")
 
(Created page with "Category:metabolite == Metabolite DNA-thymidines == * common-name: ** a thymidine in dna == Reaction(s) known to consume the compound == == Reaction(s) known to produce th...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite UDP ==
+
== Metabolite DNA-thymidines ==
 
* common-name:
 
* common-name:
−
** udp
+
** a thymidine in dna
−
* molecular-weight:
 
−
** 401.14
 
−
* inchi-key:
 
−
** xcctyiawtasojw-xvfcmesisa-k
 
−
* smiles:
 
−
** c(op(=o)([o-])op(=o)([o-])[o-])c1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[2.4.1.198-RXN]]
 
−
* [[2.4.1.94-RXN]]
 
−
* [[ExchangeSeed-UDP]]
 
−
* [[RXN-12197]]
 
−
* [[RXN-16027]]
 
−
* [[RXN0-722]]
 
−
* [[TransportSeed-UDP]]
 
−
* [[UDPKIN-RXN]]
 
−
* [[UDPREDUCT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]]
−
* [[13-BETA-GLUCAN-SYNTHASE-RXN]]
 
−
* [[2.4.1.101-RXN]]
 
−
* [[2.4.1.117-RXN]]
 
−
* [[2.4.1.141-RXN]]
 
−
* [[2.4.1.143-RXN]]
 
−
* [[2.4.1.144-RXN]]
 
−
* [[2.4.1.145-RXN]]
 
−
* [[2.4.1.149-RXN]]
 
−
* [[2.4.1.150-RXN]]
 
−
* [[2.4.1.151-RXN]]
 
−
* [[2.4.1.155-RXN]]
 
−
* [[2.4.1.198-RXN]]
 
−
* [[2.4.1.201-RXN]]
 
−
* [[2.4.1.224-RXN]]
 
−
* [[2.4.1.229-RXN]]
 
−
* [[2.4.1.38-RXN]]
 
−
* [[2.4.1.46-RXN]]
 
−
* [[2.4.1.94-RXN]]
 
−
* [[2.4.2.26-RXN]]
 
−
* [[CELLULOSE-SYNTHASE-UDP-FORMING-RXN]]
 
−
* [[ExchangeSeed-UDP]]
 
−
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[RXN-10606]]
 
−
* [[RXN-10607]]
 
−
* [[RXN-10608]]
 
−
* [[RXN-10609]]
 
−
* [[RXN-10616]]
 
−
* [[RXN-10617]]
 
−
* [[RXN-10618]]
 
−
* [[RXN-10619]]
 
−
* [[RXN-10784]]
 
−
* [[RXN-11060]]
 
−
* [[RXN-12002]]
 
−
* [[RXN-12123]]
 
−
* [[RXN-12125]]
 
−
* [[RXN-12126]]
 
−
* [[RXN-12127]]
 
−
* [[RXN-12128]]
 
−
* [[RXN-12196]]
 
−
* [[RXN-1224]]
 
−
* [[RXN-1225]]
 
−
* [[RXN-13607]]
 
−
* [[RXN-13608]]
 
−
* [[RXN-14361]]
 
−
* [[RXN-15117]]
 
−
* [[RXN-15276]]
 
−
* [[RXN-15277]]
 
−
* [[RXN-15278]]
 
−
* [[RXN-16027]]
 
−
* [[RXN-16975]]
 
−
* [[RXN-4726]]
 
−
* [[RXN-4733]]
 
−
* [[RXN-7828]]
 
−
* [[RXN-8228]]
 
−
* [[RXN-9000]]
 
−
* [[RXN1F-461]]
 
−
* [[RXN1F-462]]
 
−
* [[RXN66-162]]
 
−
* [[RXN66-168]]
 
−
* [[RXN66-83]]
 
−
* [[STEROL-GLUCOSYLTRANSFERASE-RXN]]
 
−
* [[TREHALOSE6PSYN-RXN]]
 
−
* [[TransportSeed-UDP]]
 
−
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
−
</div>
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=udp}}
+
{{#set: common-name=a thymidine in dna}}
−
{{#set: molecular-weight=401.14}}
 
−
{{#set: inchi-key=inchikey=xcctyiawtasojw-xvfcmesisa-k}}
 

Revision as of 17:54, 13 January 2021

Metabolite DNA-thymidines

  • common-name:
    • a thymidine in dna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=AN-ALPHA-L-FUCOSIDE&oldid=17947"