Difference between revisions of "Diamines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PRPP == * common-name: ** 5-phospho-α-d-ribose 1-diphosphate * molecular-weight: ** 385.031 * inchi-key: ** pqgcedqwhsbajp-txicztdv...")
 
(Created page with "Category:metabolite == Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH == * common-name: ** 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate == Reaction(s) known to cons...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PRPP ==
+
== Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH ==
 
* common-name:
 
* common-name:
** 5-phospho-α-d-ribose 1-diphosphate
+
** 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate
* molecular-weight:
 
** 385.031
 
* inchi-key:
 
** pqgcedqwhsbajp-txicztdvsa-i
 
* smiles:
 
** c(op(=o)([o-])[o-])c1(oc(op([o-])(=o)op([o-])(=o)[o-])c(o)c(o)1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPRIBOSYLTRAN-RXN]]
+
* [[RXN-10938]]
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[RXN-10958]]
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 
* [[OROPRIBTRANS-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
* [[QUINOPRIBOTRANS-RXN]]
 
* [[RXN-14270]]
 
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[2.7.1.150-RXN]]
* [[OROPRIBTRANS-RXN]]
 
* [[PRPPAMIDOTRANS-RXN]]
 
* [[PRPPSYN-RXN]]
 
* [[PRTRANS-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-phospho-α-d-ribose 1-diphosphate}}
+
{{#set: common-name=1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate}}
{{#set: molecular-weight=385.031}}
 
{{#set: inchi-key=inchikey=pqgcedqwhsbajp-txicztdvsa-i}}
 

Revision as of 17:54, 13 January 2021

Metabolite 1-PHOSPHATIDYL-1D-MYO-INOSITOL-35-BISPH

  • common-name:
    • 1-phosphatidyl-1d-myo-inositol 3,5-bisphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality