Difference between revisions of "RX"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * molecular-weight: ** 414.049 * inchi-key: ** mmwc...") |
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * molecular-weight: ** 420.263 * inchi-key: ** labspybhmpdtel-liz...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite TREHALOSE-6P == |
* common-name: | * common-name: | ||
− | ** | + | ** α,α-trehalose 6-phosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 420.263 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** labspybhmpdtel-lizsdcnhsa-l |
* smiles: | * smiles: | ||
− | ** c1( | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[TREHALOSEPHOSPHA-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[TREHALOSE6PSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α,α-trehalose 6-phosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=420.263}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}} |
Revision as of 17:55, 13 January 2021
Contents
Metabolite TREHALOSE-6P
- common-name:
- α,α-trehalose 6-phosphate
- molecular-weight:
- 420.263
- inchi-key:
- labspybhmpdtel-lizsdcnhsa-l
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o