Difference between revisions of "ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Pre-tRNA-5-prime-half-molecules == * common-name: ** a 5'-half-trna molecule with a 2',3'-cyclic phosphate end == Reaction(s) known to co...") |
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MALTOTETRAOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** maltotetraose |
+ | * molecular-weight: | ||
+ | ** 666.583 | ||
+ | * inchi-key: | ||
+ | ** luewuzlmquobsb-ayqjavfrsa-n | ||
+ | * smiles: | ||
+ | ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5182]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLYMALTOPHOSPHORYL-RXN]] |
+ | * [[RXN-14284]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=maltotetraose}} |
+ | {{#set: molecular-weight=666.583}} | ||
+ | {{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}} |
Revision as of 17:55, 13 January 2021
Contents
Metabolite MALTOTETRAOSE
- common-name:
- maltotetraose
- molecular-weight:
- 666.583
- inchi-key:
- luewuzlmquobsb-ayqjavfrsa-n
- smiles:
- c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o