Difference between revisions of "3-MERCAPTO-PYRUVATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRP-tRNAs == * common-name: ** a trnatrp == Reaction(s) known to consume the compound == * TRYPTOPHAN--TRNA-LIGASE-RXN == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite CPD-17373 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate * molecular-weight: ** 728.942 * inchi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17373 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate |
| + | * molecular-weight: | ||
| + | ** 728.942 | ||
| + | * inchi-key: | ||
| + | ** zxbgeihfxphrjy-nkfdzxfusa-l | ||
| + | * smiles: | ||
| + | ** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16121]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}} |
| + | {{#set: molecular-weight=728.942}} | ||
| + | {{#set: inchi-key=inchikey=zxbgeihfxphrjy-nkfdzxfusa-l}} | ||
Revision as of 17:56, 13 January 2021
Contents
Metabolite CPD-17373
- common-name:
- 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
- molecular-weight:
- 728.942
- inchi-key:
- zxbgeihfxphrjy-nkfdzxfusa-l
- smiles:
- c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
