Difference between revisions of "CPD-3617"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-190 == * common-name: ** n-acetyl-α-d-glucosaminyl-diphosphodolichol == Reaction(s) known to consume the compound == * 2.4.1....") |
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE == * common-name: ** pyridoxamine * molecular-weight: ** 169.203 * inchi-key: ** nhzmqxzhnvqtqa-uhfffaoysa-o * smiles: ** cc...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PYRIDOXAMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** pyridoxamine |
| + | * molecular-weight: | ||
| + | ** 169.203 | ||
| + | * inchi-key: | ||
| + | ** nhzmqxzhnvqtqa-uhfffaoysa-o | ||
| + | * smiles: | ||
| + | ** cc1(=nc=c(co)c(c[n+])=c(o)1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[PYRAMKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pyridoxamine}} |
| + | {{#set: molecular-weight=169.203}} | ||
| + | {{#set: inchi-key=inchikey=nhzmqxzhnvqtqa-uhfffaoysa-o}} | ||
Revision as of 17:56, 13 January 2021
Contents
Metabolite PYRIDOXAMINE
- common-name:
- pyridoxamine
- molecular-weight:
- 169.203
- inchi-key:
- nhzmqxzhnvqtqa-uhfffaoysa-o
- smiles:
- cc1(=nc=c(co)c(c[n+])=c(o)1)
