Difference between revisions of "5-METHYL-THF-GLU-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ISOCHORISMATE == * common-name: ** isochorismate * molecular-weight: ** 224.17 * inchi-key: ** ntgwprccoqcmge-yumqzzprsa-l * smiles: ** c...")
 
(Created page with "Category:metabolite == Metabolite 5-METHYL-THF-GLU-N == * common-name: ** a 5-methyltetrahydrofolate == Reaction(s) known to consume the compound == * 2.1.1.19-RXN * [...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ISOCHORISMATE ==
+
== Metabolite 5-METHYL-THF-GLU-N ==
 
* common-name:
 
* common-name:
** isochorismate
+
** a 5-methyltetrahydrofolate
* molecular-weight:
 
** 224.17
 
* inchi-key:
 
** ntgwprccoqcmge-yumqzzprsa-l
 
* smiles:
 
** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.5.1.64-RXN]]
+
* [[2.1.1.19-RXN]]
 +
* [[HOMOCYSMETB12-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[1.5.1.20-RXN]]
 +
* [[RXN-5061]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=isochorismate}}
+
{{#set: common-name=a 5-methyltetrahydrofolate}}
{{#set: molecular-weight=224.17}}
 
{{#set: inchi-key=inchikey=ntgwprccoqcmge-yumqzzprsa-l}}
 

Revision as of 17:56, 13 January 2021

Metabolite 5-METHYL-THF-GLU-N

  • common-name:
    • a 5-methyltetrahydrofolate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality