Difference between revisions of "3-HYDROXY-3-METHYL-GLUTARYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DOCOSANOATE == * common-name: ** behenate * molecular-weight: ** 339.58 * inchi-key: ** ukmsunontopoio-uhfffaoysa-m * smiles: ** cccccccc...") |
(Created page with "Category:metabolite == Metabolite CPD-11674 == * common-name: ** 5-hydroxytryptophol sulfate * molecular-weight: ** 256.253 * inchi-key: ** focuajyuoxsnds-uhfffaoysa-m * s...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11674 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxytryptophol sulfate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 256.253 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** focuajyuoxsnds-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-10782]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxytryptophol sulfate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=256.253}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=focuajyuoxsnds-uhfffaoysa-m}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-11674
- common-name:
- 5-hydroxytryptophol sulfate
- molecular-weight:
- 256.253
- inchi-key:
- focuajyuoxsnds-uhfffaoysa-m
- smiles:
- c(o)cc1(=cnc2(=c1c=c(os(=o)(=o)[o-])c=c2))
