Difference between revisions of "Thiocarboxylated-MPT-synthases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CELLOBIOSE == * common-name: ** β-d-cellobiose * molecular-weight: ** 342.299 * inchi-key: ** gubgytabksrvrq-qrzgkkjrsa-n * smiles:...")
 
(Created page with "Category:metabolite == Metabolite URACIL == * common-name: ** uracil * molecular-weight: ** 112.088 * inchi-key: ** isakrjdgnuqoic-uhfffaoysa-n * smiles: ** c1(=cc(nc(=o)n...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CELLOBIOSE ==
+
== Metabolite URACIL ==
 
* common-name:
 
* common-name:
** β-d-cellobiose
+
** uracil
 
* molecular-weight:
 
* molecular-weight:
** 342.299
+
** 112.088
 
* inchi-key:
 
* inchi-key:
** gubgytabksrvrq-qrzgkkjrsa-n
+
** isakrjdgnuqoic-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(c2(c(c(c(c(oc1(c(oc(c(c1o)o)o)co))o2)o)o)o))o
+
** c1(=cc(nc(=o)n1)=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10773]]
+
* [[RXN0-5398]]
 +
* [[URACIL-PRIBOSYLTRANS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-5398]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=β-d-cellobiose}}
+
{{#set: common-name=uracil}}
{{#set: molecular-weight=342.299}}
+
{{#set: molecular-weight=112.088}}
{{#set: inchi-key=inchikey=gubgytabksrvrq-qrzgkkjrsa-n}}
+
{{#set: inchi-key=inchikey=isakrjdgnuqoic-uhfffaoysa-n}}

Revision as of 17:57, 13 January 2021

Metabolite URACIL

  • common-name:
    • uracil
  • molecular-weight:
    • 112.088
  • inchi-key:
    • isakrjdgnuqoic-uhfffaoysa-n
  • smiles:
    • c1(=cc(nc(=o)n1)=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality