Difference between revisions of "2-KETO-ISOVALERATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite IMINOASPARTATE == * common-name: ** 2-iminosuccinate * molecular-weight: ** 129.072 * inchi-key: ** nmuoatvllqeyhi-uhfffaoysa-l * smiles:...") |
(Created page with "Category:metabolite == Metabolite CPD-5661 == * common-name: ** zeinoxanthin * molecular-weight: ** 552.882 * inchi-key: ** nbzanzvjrkxvbh-nhwxejklsa-n * smiles: ** cc(c=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-5661 == |
* common-name: | * common-name: | ||
| − | ** | + | ** zeinoxanthin |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 552.882 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** nbzanzvjrkxvbh-nhwxejklsa-n |
* smiles: | * smiles: | ||
| − | ** c(= | + | ** cc(c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))=cc=cc=c(c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-5962]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=zeinoxanthin}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=552.882}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=nbzanzvjrkxvbh-nhwxejklsa-n}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-5661
- common-name:
- zeinoxanthin
- molecular-weight:
- 552.882
- inchi-key:
- nbzanzvjrkxvbh-nhwxejklsa-n
- smiles:
- cc(c=cc=c(c)c=cc1(c(c)(c)ccc=c(c)1))=cc=cc=c(c)c=cc=c(c)c=cc2(c(c)(c)cc(o)cc(c)=2)
