Difference between revisions of "2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2-KETO-ISOVALERATE == * common-name: ** 3-methyl-2-oxobutanoate * molecular-weight: ** 115.108 * inchi-key: ** qhkabhooewyvli-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == * common-name: ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate * molecular-weigh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite 2-KETO- | + | == Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP == |
* common-name: | * common-name: | ||
− | ** 3- | + | ** 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 239.159 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yiemfvncenfbsd-xqrvvysfsa-k |
* smiles: | * smiles: | ||
− | ** | + | ** csccc(c([o-])=cop([o-])(=o)[o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[R83-RXN]] |
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[R82-RXN]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=3- | + | {{#set: common-name=2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=239.159}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yiemfvncenfbsd-xqrvvysfsa-k}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP
- common-name:
- 2-hydroxy-5-(methylsulfanyl)-3-oxopent-1-enyl 1-phosphate
- molecular-weight:
- 239.159
- inchi-key:
- yiemfvncenfbsd-xqrvvysfsa-k
- smiles:
- csccc(c([o-])=cop([o-])(=o)[o-])=o