Difference between revisions of "16S-rRNA-N2-methylguanine966"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18238 == * common-name: ** carboxyphosphate * molecular-weight: ** 139.989 * inchi-key: ** lqqcgegrinlhdp-uhfffaoysa-l * smiles: ** c...") |
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * molecular-weight: ** 544.946 * inchi-key: ** yvlpjigomtxxlp-bhljudrvsa-n * smiles: ** cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-12321 == |
* common-name: | * common-name: | ||
− | ** | + | ** 15-cis-phytoene |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 544.946 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** yvlpjigomtxxlp-bhljudrvsa-n |
* smiles: | * smiles: | ||
− | ** c(= | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-13323]] |
+ | * [[RXNARA-8002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=15-cis-phytoene}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=544.946}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=yvlpjigomtxxlp-bhljudrvsa-n}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-12321
- common-name:
- 15-cis-phytoene
- molecular-weight:
- 544.946
- inchi-key:
- yvlpjigomtxxlp-bhljudrvsa-n
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c