Difference between revisions of "Heme-b"
Jump to navigation
Jump to search
(Created page with "{{#ask: Category:gene | ?organism associated | ?nb reaction associated | ?nb pathway associated |sort=nb reaction associated |order=descending }}") |
(Created page with "Category:metabolite == Metabolite CPD-14602 == * common-name: ** mycophenolic acid o-acyl-glucuronide * molecular-weight: ** 495.459 * inchi-key: ** qbmstezxamabff-uearnrk...") |
||
| Line 1: | Line 1: | ||
| − | + | [[Category:metabolite]] | |
| − | + | == Metabolite CPD-14602 == | |
| − | + | * common-name: | |
| − | + | ** mycophenolic acid o-acyl-glucuronide | |
| − | + | * molecular-weight: | |
| − | + | ** 495.459 | |
| − | }} | + | * inchi-key: |
| + | ** qbmstezxamabff-uearnrkisa-m | ||
| + | * smiles: | ||
| + | ** cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc) | ||
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13607]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=mycophenolic acid o-acyl-glucuronide}} | ||
| + | {{#set: molecular-weight=495.459}} | ||
| + | {{#set: inchi-key=inchikey=qbmstezxamabff-uearnrkisa-m}} | ||
Revision as of 17:58, 13 January 2021
Contents
Metabolite CPD-14602
- common-name:
- mycophenolic acid o-acyl-glucuronide
- molecular-weight:
- 495.459
- inchi-key:
- qbmstezxamabff-uearnrkisa-m
- smiles:
- cc(ccc(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(o)2)3))oc)
