Difference between revisions of "3-SULFINYL-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19151 == * common-name: ** (s)-3-hydroxy-(5z)-dodecenoyl-coa * molecular-weight: ** 959.791 * inchi-key: ** ayordfmyybnsbo-qccsjadrsa...")
(Created page with "Category:metabolite == Metabolite GLN == * common-name: ** l-glutamine * molecular-weight: ** 146.146 * inchi-key: ** zdxpyrjpndtmrx-vkhmyheasa-n * smiles: ** c(=o)(n)ccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-19151 ==
+
== Metabolite GLN ==
 
* common-name:
 
* common-name:
−
** (s)-3-hydroxy-(5z)-dodecenoyl-coa
+
** l-glutamine
 
* molecular-weight:
 
* molecular-weight:
−
** 959.791
+
** 146.146
 
* inchi-key:
 
* inchi-key:
−
** ayordfmyybnsbo-qccsjadrsa-j
+
** zdxpyrjpndtmrx-vkhmyheasa-n
 
* smiles:
 
* smiles:
−
** ccccccc=ccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(=o)(n)ccc([n+])c([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-17798]]
+
* [[6.3.5.7-RXN]]
 +
* [[ANTHRANSYN-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[FGAMSYN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-FERREDOXIN-RXN]]
 +
* [[GLUTAMATE-SYNTHASE-NADH-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTAMIDOTRANS-RXN]]
 +
* [[GLUTAMIN-RXN]]
 +
* [[GLUTAMINE--PYRUVATE-AMINOTRANSFERASE-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-17797]]
+
* [[ANTHRANSYN-RXN]]
 +
* [[GLUTAMINE--PYRUVATE-AMINOTRANSFERASE-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[L-GLN-FRUCT-6-P-AMINOTRANS-RXN]]
 +
* [[PABASYN-RXN]]
 +
* [[PRPPAMIDOTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(s)-3-hydroxy-(5z)-dodecenoyl-coa}}
+
{{#set: common-name=l-glutamine}}
−
{{#set: molecular-weight=959.791}}
+
{{#set: molecular-weight=146.146}}
−
{{#set: inchi-key=inchikey=ayordfmyybnsbo-qccsjadrsa-j}}
+
{{#set: inchi-key=inchikey=zdxpyrjpndtmrx-vkhmyheasa-n}}

Revision as of 15:04, 15 March 2021

Metabolite GLN

  • common-name:
    • l-glutamine
  • molecular-weight:
    • 146.146
  • inchi-key:
    • zdxpyrjpndtmrx-vkhmyheasa-n
  • smiles:
    • c(=o)(n)ccc([n+])c([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=3-SULFINYL-PYRUVATE&oldid=27259"