Difference between revisions of "1-INDANONE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12366 == * common-name: ** 8-oxo-gtp * molecular-weight: ** 535.151 * inchi-key: ** jchlkiqzuxylpw-ummcilcdsa-j * smiles: ** c(op(=o)...")
(Created page with "Category:metabolite == Metabolite Oxidized-adrenal-ferredoxins == * common-name: ** an oxidized adrenodoxin == Reaction(s) known to consume the compound == * RXN-13685...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12366 ==
+
== Metabolite Oxidized-adrenal-ferredoxins ==
 
* common-name:
 
* common-name:
** 8-oxo-gtp
+
** an oxidized adrenodoxin
* molecular-weight:
 
** 535.151
 
* inchi-key:
 
** jchlkiqzuxylpw-ummcilcdsa-j
 
* smiles:
 
** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(c(o)c(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-13685]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11409]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8-oxo-gtp}}
+
{{#set: common-name=an oxidized adrenodoxin}}
{{#set: molecular-weight=535.151}}
 
{{#set: inchi-key=inchikey=jchlkiqzuxylpw-ummcilcdsa-j}}
 

Revision as of 15:05, 15 March 2021

Metabolite Oxidized-adrenal-ferredoxins

  • common-name:
    • an oxidized adrenodoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality