Difference between revisions of "CPD-24185"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROKAEMPFEROL-CMPD == * common-name: ** (+)-dihydrokaempferol * molecular-weight: ** 288.256 * inchi-key: ** padqinqhpqkxnl-lsdhhaius...")
(Created page with "Category:metabolite == Metabolite CPD-15364 == * common-name: ** ricinoleoyl-coa * molecular-weight: ** 1043.952 * inchi-key: ** bhvzcckrrpyxcv-mgnvxpimsa-j * smiles: ** c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIHYDROKAEMPFEROL-CMPD ==
+
== Metabolite CPD-15364 ==
 
* common-name:
 
* common-name:
** (+)-dihydrokaempferol
+
** ricinoleoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 288.256
+
** 1043.952
 
* inchi-key:
 
* inchi-key:
** padqinqhpqkxnl-lsdhhaiusa-n
+
** bhvzcckrrpyxcv-mgnvxpimsa-j
 
* smiles:
 
* smiles:
** c1(=c(c=cc(=c1)o)c2(oc3(c(c(c2o)=o)=c(o)c=c(o)c=3)))
+
** ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
+
* [[RXN-16151]]
* [[RXN1F-93]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+
* [[RXN-16151]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydrokaempferol}}
+
{{#set: common-name=ricinoleoyl-coa}}
{{#set: molecular-weight=288.256}}
+
{{#set: molecular-weight=1043.952}}
{{#set: inchi-key=inchikey=padqinqhpqkxnl-lsdhhaiusa-n}}
+
{{#set: inchi-key=inchikey=bhvzcckrrpyxcv-mgnvxpimsa-j}}

Revision as of 15:06, 15 March 2021

Metabolite CPD-15364

  • common-name:
    • ricinoleoyl-coa
  • molecular-weight:
    • 1043.952
  • inchi-key:
    • bhvzcckrrpyxcv-mgnvxpimsa-j
  • smiles:
    • ccccccc(o)cc=ccccccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality