Difference between revisions of "3-CARBOXY-3-HYDROXY-ISOCAPROATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TETRADEHYDROACYL-COA == * common-name: ** a (2e,4e)-alka-2,4-dienoyl-coa == Reaction(s) known to consume the compound == * RXN-12521...") |
(Created page with "Category:metabolite == Metabolite CPD-15322 == * common-name: ** l-homophenylalanine * molecular-weight: ** 179.218 * inchi-key: ** jtthkopsmavjfe-vifpvbqesa-n * smiles: *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15322 == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-homophenylalanine |
| + | * molecular-weight: | ||
| + | ** 179.218 | ||
| + | * inchi-key: | ||
| + | ** jtthkopsmavjfe-vifpvbqesa-n | ||
| + | * smiles: | ||
| + | ** c(=o)([o-])c([n+])ccc1(c=cc=cc=1) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-14467]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-14467]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-homophenylalanine}} |
| + | {{#set: molecular-weight=179.218}} | ||
| + | {{#set: inchi-key=inchikey=jtthkopsmavjfe-vifpvbqesa-n}} | ||
Revision as of 15:06, 15 March 2021
Contents
Metabolite CPD-15322
- common-name:
- l-homophenylalanine
- molecular-weight:
- 179.218
- inchi-key:
- jtthkopsmavjfe-vifpvbqesa-n
- smiles:
- c(=o)([o-])c([n+])ccc1(c=cc=cc=1)
