Difference between revisions of "2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-731 == * common-name: ** (+)-7-epi-jasmonate * molecular-weight: ** 209.264 * inchi-key: ** znjfbwydhiglcu-qkmqqoolsa-m * smiles: **...")
(Created page with "Category:metabolite == Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL == * common-name: ** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosam...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-731 ==
+
== Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL ==
 
* common-name:
 
* common-name:
−
** (+)-7-epi-jasmonate
+
** an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r
−
* molecular-weight:
 
−
** 209.264
 
−
* inchi-key:
 
−
** znjfbwydhiglcu-qkmqqoolsa-m
 
−
* smiles:
 
−
** ccc=ccc1(c(=o)ccc1cc([o-])=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-10708]]
+
* [[2.4.1.151-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=(+)-7-epi-jasmonate}}
+
{{#set: common-name=an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r}}
−
{{#set: molecular-weight=209.264}}
 
−
{{#set: inchi-key=inchikey=znjfbwydhiglcu-qkmqqoolsa-m}}
 

Revision as of 15:06, 15 March 2021

Metabolite ALPHA-D-GALACTOSYL-ETCETERA-GLUCOSAMINYL

  • common-name:
    • an α-d-galactosyl-(1,3)-β-d-galactosyl-(1,4)-n-acetyl-d-glucosaminyl-r

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=2-AMINO-3-3-OXOPROP-2-ENYL-BUT-2-ENEDI&oldid=27736"