Difference between revisions of "MRNAs"

Revision as of 15:07, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-1301 ==
+== Metabolite CPD-18761 ==
 * common-name:
-** tetrahydropteroyl tri-l-glutamate
+** coniferyl alcohol radical
 * molecular-weight:
-** 699.633
+** 179.195
 * inchi-key:
-** rxwvhryztwzath-xslagttesa-j
+** orajwsykrgvtdp-uhfffaoysa-n
 * smiles:
-** c([ch]2(nc1(c(nc(=nc=1nc2)n)=o)))nc3(=cc=c(c(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc(nc(c(=o)[o-])ccc([o-])=o)=o)=o)=o)c=c3)
+** coc1(=cc(=ccco)c=cc(=o)1)
 == Reaction(s) known to consume the compound ==
-* [[HOMOCYSMET-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[HOMOCYSMET-RXN]]
+* [[RXN-17352]]
-* [[RXN-12730]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=tetrahydropteroyl tri-l-glutamate}}
+{{#set: common-name=coniferyl alcohol radical}}
-{{#set: molecular-weight=699.633}}
+{{#set: molecular-weight=179.195}}
-{{#set: inchi-key=inchikey=rxwvhryztwzath-xslagttesa-j}}
+{{#set: inchi-key=inchikey=orajwsykrgvtdp-uhfffaoysa-n}}