Difference between revisions of "L-arabinofuranose"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * molecular-weight: ** 650.978 * inchi-key: ** auyycjsjgjycds-lbprgkrzsa-n *...") |
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * molecular-weight: ** 340.283 * inchi-key: ** hkkhtabthsudbp-gihchdtpsa-n * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-KETOLACTOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3'-ketolactose |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 340.283 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hkkhtabthsudbp-gihchdtpsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[KETOLACTOSE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3'-ketolactose}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=340.283}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hkkhtabthsudbp-gihchdtpsa-n}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite 3-KETOLACTOSE
- common-name:
- 3'-ketolactose
- molecular-weight:
- 340.283
- inchi-key:
- hkkhtabthsudbp-gihchdtpsa-n
- smiles:
- c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2)
