Difference between revisions of "ASP-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17397 == * common-name: ** a [glycerolipid]-densipolate == Reaction(s) known to consume the compound == * RXN-16150 == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-8268 == * common-name: ** dioleoyl phosphatidate * molecular-weight: ** 698.959 * inchi-key: ** mhuwzntuiifhas-dssvuwshsa-l * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8268 == |
* common-name: | * common-name: | ||
| − | ** | + | ** dioleoyl phosphatidate |
| + | * molecular-weight: | ||
| + | ** 698.959 | ||
| + | * inchi-key: | ||
| + | ** mhuwzntuiifhas-dssvuwshsa-l | ||
| + | * smiles: | ||
| + | ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15068]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15043]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dioleoyl phosphatidate}} |
| + | {{#set: molecular-weight=698.959}} | ||
| + | {{#set: inchi-key=inchikey=mhuwzntuiifhas-dssvuwshsa-l}} | ||
Revision as of 15:08, 15 March 2021
Contents
Metabolite CPD-8268
- common-name:
- dioleoyl phosphatidate
- molecular-weight:
- 698.959
- inchi-key:
- mhuwzntuiifhas-dssvuwshsa-l
- smiles:
- ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccccccccc)cop([o-])(=o)[o-])=o
