Difference between revisions of "Sugar"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-2 == * common-name: ** (-)-methyl jasmonate * molecular-weight: ** 224.299 * inchi-key: ** gewdntwnsazudx-wqmvxfaesa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite METHYLENETETRAHYDROMETHANOPTERIN == * common-name: ** 5,10-methylene-tetrahydromethanopterin * molecular-weight: ** 785.677 * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-2 ==
+
== Metabolite METHYLENETETRAHYDROMETHANOPTERIN ==
 
* common-name:
 
* common-name:
** (-)-methyl jasmonate
+
** 5,10-methylene-tetrahydromethanopterin
 
* molecular-weight:
 
* molecular-weight:
** 224.299
+
** 785.677
 
* inchi-key:
 
* inchi-key:
** gewdntwnsazudx-wqmvxfaesa-n
+
** gbmigewjapfsqi-cafbyhecsa-k
 
* smiles:
 
* smiles:
** ccc=ccc1(c(=o)ccc1cc(oc)=o)
+
** cc4([ch]3(c(c)n(c2(c=cc(cc(o)c(o)c(o)coc1(c(o)c(c(cop([o-])(=o)oc(c(=o)[o-])ccc(=o)[o-])o1)o))=cc=2))cn3c5(c(=o)nc(n)=nc(n4)=5)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10767]]
+
* [[RXN-15635]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(-)-methyl jasmonate}}
+
{{#set: common-name=5,10-methylene-tetrahydromethanopterin}}
{{#set: molecular-weight=224.299}}
+
{{#set: molecular-weight=785.677}}
{{#set: inchi-key=inchikey=gewdntwnsazudx-wqmvxfaesa-n}}
+
{{#set: inchi-key=inchikey=gbmigewjapfsqi-cafbyhecsa-k}}

Revision as of 15:08, 15 March 2021

Metabolite METHYLENETETRAHYDROMETHANOPTERIN

  • common-name:
    • 5,10-methylene-tetrahydromethanopterin
  • molecular-weight:
    • 785.677
  • inchi-key:
    • gbmigewjapfsqi-cafbyhecsa-k
  • smiles:
    • cc4([ch]3(c(c)n(c2(c=cc(cc(o)c(o)c(o)coc1(c(o)c(c(cop([o-])(=o)oc(c(=o)[o-])ccc(=o)[o-])o1)o))=cc=2))cn3c5(c(=o)nc(n)=nc(n4)=5)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality