Difference between revisions of "AMMONIA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-UREIDO-ISOBUTYRATE == * common-name: ** 3-(carbamoylamino)-2-methylpropanoate * molecular-weight: ** 145.138 * inchi-key: ** phentznalb...") |
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * molecular-weight: ** 546.317 * inchi-key: ** zosqfdvxnqfkby-cgaxjhmrsa-l * sm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DTDP-RHAMNOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** dtdp-β-l-rhamnose |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 546.317 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** zosqfdvxnqfkby-cgaxjhmrsa-l |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
+ | * [[DTDPRHAMSYNTHMULTI-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[DTDPDEHYRHAMREDUCT-RXN]] | ||
+ | * [[DTDPRHAMSYNTHMULTI-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=dtdp-β-l-rhamnose}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=546.317}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite DTDP-RHAMNOSE
- common-name:
- dtdp-β-l-rhamnose
- molecular-weight:
- 546.317
- inchi-key:
- zosqfdvxnqfkby-cgaxjhmrsa-l
- smiles:
- cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))