Difference between revisions of "AMMONIA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-UREIDO-ISOBUTYRATE == * common-name: ** 3-(carbamoylamino)-2-methylpropanoate * molecular-weight: ** 145.138 * inchi-key: ** phentznalb...")
(Created page with "Category:metabolite == Metabolite DTDP-RHAMNOSE == * common-name: ** dtdp-β-l-rhamnose * molecular-weight: ** 546.317 * inchi-key: ** zosqfdvxnqfkby-cgaxjhmrsa-l * sm...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-UREIDO-ISOBUTYRATE ==
+
== Metabolite DTDP-RHAMNOSE ==
 
* common-name:
 
* common-name:
** 3-(carbamoylamino)-2-methylpropanoate
+
** dtdp-β-l-rhamnose
 
* molecular-weight:
 
* molecular-weight:
** 145.138
+
** 546.317
 
* inchi-key:
 
* inchi-key:
** phentznalbmcqd-gsvougtgsa-m
+
** zosqfdvxnqfkby-cgaxjhmrsa-l
 
* smiles:
 
* smiles:
** cc(cnc(n)=o)c(=o)[o-]
+
** cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11210]]
+
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[DTDPRHAMSYNTHMULTI-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[DTDPRHAMSYNTHMULTI-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(carbamoylamino)-2-methylpropanoate}}
+
{{#set: common-name=dtdp-β-l-rhamnose}}
{{#set: molecular-weight=145.138}}
+
{{#set: molecular-weight=546.317}}
{{#set: inchi-key=inchikey=phentznalbmcqd-gsvougtgsa-m}}
+
{{#set: inchi-key=inchikey=zosqfdvxnqfkby-cgaxjhmrsa-l}}

Revision as of 15:08, 15 March 2021

Metabolite DTDP-RHAMNOSE

  • common-name:
    • dtdp-β-l-rhamnose
  • molecular-weight:
    • 546.317
  • inchi-key:
    • zosqfdvxnqfkby-cgaxjhmrsa-l
  • smiles:
    • cc1(=cn(c(=o)nc(=o)1)c3(cc(o)c(cop(=o)([o-])op(=o)([o-])oc2(oc(c)c(o)c(o)c(o)2))o3))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality