Difference between revisions of "23S-rRNA-guanine-1835"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-22095 == == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * RXN-22198 == Reaction(...")
(Created page with "Category:metabolite == Metabolite MALTOPENTAOSE == * common-name: ** maltopentaose * molecular-weight: ** 828.725 * inchi-key: ** ftnipwxxignqqf-hzwihctqsa-n * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-22095 ==
+
== Metabolite MALTOPENTAOSE ==
 +
* common-name:
 +
** maltopentaose
 +
* molecular-weight:
 +
** 828.725
 +
* inchi-key:
 +
** ftnipwxxignqqf-hzwihctqsa-n
 +
* smiles:
 +
** c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14284]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-22198]]
+
* [[RXN-14285]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=maltopentaose}}
 +
{{#set: molecular-weight=828.725}}
 +
{{#set: inchi-key=inchikey=ftnipwxxignqqf-hzwihctqsa-n}}

Revision as of 15:08, 15 March 2021

Metabolite MALTOPENTAOSE

  • common-name:
    • maltopentaose
  • molecular-weight:
    • 828.725
  • inchi-key:
    • ftnipwxxignqqf-hzwihctqsa-n
  • smiles:
    • c(c5(oc(oc4(c(oc(oc1(c(oc(c(c1o)o)oc2(c(oc(c(c2o)o)oc3(c(oc(c(c3o)o)o)co))co))co))c(c4o)o)co))c(c(c5o)o)o))o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality