Difference between revisions of "Nucleotides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * molecular-weight: ** 297.457 * inchi-key: ** lquhzvlttwmbto-uphrsurjsa-m * smile...") |
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * molecular-weight: ** 831.577 * inchi-key: ** kfwwcmjsysspsk-bogfjhsmsa-j * smiles: ** cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CROTONYL-COA == |
* common-name: | * common-name: | ||
− | ** | + | ** crotonyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 831.577 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kfwwcmjsysspsk-bogfjhsmsa-j |
* smiles: | * smiles: | ||
− | ** c(o) | + | ** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[BUTYRYL-COA-DEHYDROGENASE-RXN]] |
+ | * [[RXN-11667]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[BUTYRYL-COA-DEHYDROGENASE-RXN]] | ||
+ | * [[RXN-11667]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=crotonyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=831.577}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}} |
Revision as of 15:09, 15 March 2021
Contents
Metabolite CROTONYL-COA
- common-name:
- crotonyl-coa
- molecular-weight:
- 831.577
- inchi-key:
- kfwwcmjsysspsk-bogfjhsmsa-j
- smiles:
- cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o