Difference between revisions of "CPD-14425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite TRIMETHYLAMINE == * common-name: ** trimethylamine * molecular-weight: ** 60.119 * inchi-key: ** getqzclcwqtvfv-uhfffaoysa-o * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * molecular-weight: ** 943.792 * inchi-key: ** rcvjzgbrlgutkt-cggpsvllsa-j * smiles: *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite TRIMETHYLAMINE ==
+
== Metabolite CPD-19148 ==
 
* common-name:
 
* common-name:
** trimethylamine
+
** (5z)-dodecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 60.119
+
** 943.792
 
* inchi-key:
 
* inchi-key:
** getqzclcwqtvfv-uhfffaoysa-o
+
** rcvjzgbrlgutkt-cggpsvllsa-j
 
* smiles:
 
* smiles:
** c[n+](c)c
+
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8102]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-17795]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=trimethylamine}}
+
{{#set: common-name=(5z)-dodecenoyl-coa}}
{{#set: molecular-weight=60.119}}
+
{{#set: molecular-weight=943.792}}
{{#set: inchi-key=inchikey=getqzclcwqtvfv-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}

Revision as of 15:10, 15 March 2021

Metabolite CPD-19148

  • common-name:
    • (5z)-dodecenoyl-coa
  • molecular-weight:
    • 943.792
  • inchi-key:
    • rcvjzgbrlgutkt-cggpsvllsa-j
  • smiles:
    • ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality