Difference between revisions of "ALPHA-N-ACETYLNEURAMINYL-23-BETA-ETCETER"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...")
(Created page with "Category:metabolite == Metabolite NIACINAMIDE == * common-name: ** nicotinamide * molecular-weight: ** 122.126 * inchi-key: ** dfpaksucgfbddf-uhfffaoysa-n * smiles: ** c1(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite MALTOTETRAOSE ==
+
== Metabolite NIACINAMIDE ==
 
* common-name:
 
* common-name:
** maltotetraose
+
** nicotinamide
 
* molecular-weight:
 
* molecular-weight:
** 666.583
+
** 122.126
 
* inchi-key:
 
* inchi-key:
** luewuzlmquobsb-ayqjavfrsa-n
+
** dfpaksucgfbddf-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o
+
** c1(=nc=c(c(=o)n)c=c1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-5182]]
+
* [[2.4.2.31-RXN]]
 +
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GLYMALTOPHOSPHORYL-RXN]]
+
* [[2.4.2.31-RXN]]
* [[RXN-14284]]
+
* [[2.7.1.160-RXN]]
 +
* [[NAD+-ADP-RIBOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=maltotetraose}}
+
{{#set: common-name=nicotinamide}}
{{#set: molecular-weight=666.583}}
+
{{#set: molecular-weight=122.126}}
{{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}}
+
{{#set: inchi-key=inchikey=dfpaksucgfbddf-uhfffaoysa-n}}

Revision as of 15:10, 15 March 2021

Metabolite NIACINAMIDE

  • common-name:
    • nicotinamide
  • molecular-weight:
    • 122.126
  • inchi-key:
    • dfpaksucgfbddf-uhfffaoysa-n
  • smiles:
    • c1(=nc=c(c(=o)n)c=c1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality