Difference between revisions of "3-MERCAPTO-PYRUVATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17373 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate * molecular-weight: ** 728.942 * inchi...")
(Created page with "Category:metabolite == Metabolite SS-DIMETHYL-BETA-PROPIOTHETIN == * common-name: ** dimethylsulfoniopropanoate * molecular-weight: ** 134.193 * inchi-key: ** dfpoztrsoaqf...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17373 ==
+
== Metabolite SS-DIMETHYL-BETA-PROPIOTHETIN ==
 
* common-name:
 
* common-name:
** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate
+
** dimethylsulfoniopropanoate
 
* molecular-weight:
 
* molecular-weight:
** 728.942
+
** 134.193
 
* inchi-key:
 
* inchi-key:
** zxbgeihfxphrjy-nkfdzxfusa-l
+
** dfpoztrsoaqfik-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccco)cop([o-])(=o)[o-])=o
+
** c[s+](c)ccc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16121]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-9758]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol 3-phosphate}}
+
{{#set: common-name=dimethylsulfoniopropanoate}}
{{#set: molecular-weight=728.942}}
+
{{#set: molecular-weight=134.193}}
{{#set: inchi-key=inchikey=zxbgeihfxphrjy-nkfdzxfusa-l}}
+
{{#set: inchi-key=inchikey=dfpoztrsoaqfik-uhfffaoysa-n}}

Revision as of 15:11, 15 March 2021

Metabolite SS-DIMETHYL-BETA-PROPIOTHETIN

  • common-name:
    • dimethylsulfoniopropanoate
  • molecular-weight:
    • 134.193
  • inchi-key:
    • dfpoztrsoaqfik-uhfffaoysa-n
  • smiles:
    • c[s+](c)ccc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality