Difference between revisions of "ALA-tRNAs"

Revision as of 15:11, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite PHENYLACETATE ==
+== Metabolite SULFATE ==
 * common-name:
-** phenylacetate
+** sulfate
 * molecular-weight:
-** 135.142
+** 96.058
 * inchi-key:
-** wljvxdmoqogphl-uhfffaoysa-m
+** qaowncqodcnurd-uhfffaoysa-l
 * smiles:
-** c1(=cc=c(c=c1)cc([o-])=o)
+** o=s(=o)([o-])[o-]
 == Reaction(s) known to consume the compound ==
-* [[PHENDEHYD-RXN]]
+* [[ExchangeSeed-SULFATE]]
+* [[FESO3OXI-RXN]]
+* [[SULFATE-ADENYLYLTRANS-RXN]]
+* [[TransportSeed-SULFATE]]
 == Reaction(s) known to produce the compound ==
-* [[PHENDEHYD-RXN]]
+* [[3.1.6.12-RXN]]
+* [[ADENYLYLSULFATASE-RXN]]
+* [[ARYLSULFAT-RXN]]
+* [[ExchangeSeed-SULFATE]]
+* [[FESO3OXI-RXN]]
+* [[SULFATE-ADENYLYLTRANS-RXN]]
+* [[SULFITE-OXIDASE-RXN]]
+* [[TransportSeed-SULFATE]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=phenylacetate}}
+{{#set: common-name=sulfate}}
-{{#set: molecular-weight=135.142}}
+{{#set: molecular-weight=96.058}}
-{{#set: inchi-key=inchikey=wljvxdmoqogphl-uhfffaoysa-m}}
+{{#set: inchi-key=inchikey=qaowncqodcnurd-uhfffaoysa-l}}