Difference between revisions of "Alkyl-Hydro-Peroxides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Alkyl-Hydro-Peroxides == * common-name: ** an organic hydroperoxide == Reaction(s) known to consume the compound == * 1.11.1.15-RXN =...") |
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * molecular-weight: ** 889.7 * inchi-key: ** kqmzyoxobsxmii-cecatxlmsa-j * smiles: ** cccccccc(...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-196 == |
* common-name: | * common-name: | ||
− | ** | + | ** octanoyl-coa |
+ | * molecular-weight: | ||
+ | ** 889.7 | ||
+ | * inchi-key: | ||
+ | ** kqmzyoxobsxmii-cecatxlmsa-j | ||
+ | * smiles: | ||
+ | ** cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-12669]] |
+ | * [[RXN-14229]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[R223-RXN]] | ||
+ | * [[RXN-13617]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=octanoyl-coa}} |
+ | {{#set: molecular-weight=889.7}} | ||
+ | {{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}} |
Revision as of 15:12, 15 March 2021
Contents
Metabolite CPD-196
- common-name:
- octanoyl-coa
- molecular-weight:
- 889.7
- inchi-key:
- kqmzyoxobsxmii-cecatxlmsa-j
- smiles:
- cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]