Difference between revisions of "3-P-SERINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-P-SERINE == * common-name: ** 3-phospho-l-serine * molecular-weight: ** 183.057 * inchi-key: ** bzqfbwgglxlepq-reohclbhsa-l * smiles: *...")
(Created page with "Category:metabolite == Metabolite CPD0-2117 == * common-name: ** (2e)-hexadecenoyl-coa * molecular-weight: ** 999.899 * inchi-key: ** jupaqfrkphpxld-mshhsvqmsa-j * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-P-SERINE ==
+
== Metabolite CPD0-2117 ==
 
* common-name:
 
* common-name:
** 3-phospho-l-serine
+
** (2e)-hexadecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 183.057
+
** 999.899
 
* inchi-key:
 
* inchi-key:
** bzqfbwgglxlepq-reohclbhsa-l
+
** jupaqfrkphpxld-mshhsvqmsa-j
 
* smiles:
 
* smiles:
** c(op([o-])([o-])=o)c([n+])c(=o)[o-]
+
** cccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[RXN-14272]]
* [[RXN0-5114]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PSERTRANSAM-RXN]]
+
* [[RXN-16540]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-phospho-l-serine}}
+
{{#set: common-name=(2e)-hexadecenoyl-coa}}
{{#set: molecular-weight=183.057}}
+
{{#set: molecular-weight=999.899}}
{{#set: inchi-key=inchikey=bzqfbwgglxlepq-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=jupaqfrkphpxld-mshhsvqmsa-j}}

Revision as of 15:12, 15 March 2021

Metabolite CPD0-2117

  • common-name:
    • (2e)-hexadecenoyl-coa
  • molecular-weight:
    • 999.899
  • inchi-key:
    • jupaqfrkphpxld-mshhsvqmsa-j
  • smiles:
    • cccccccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality