Difference between revisions of "2-phospho-ligated-tRNA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-D-GLUCOSAMINE-6-P == * common-name: ** n-acetyl-d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * PH...") |
(Created page with "Category:metabolite == Metabolite PHOSPHORYL-CHOLINE == * common-name: ** phosphocholine * molecular-weight: ** 182.136 * inchi-key: ** yhhsonzfoiemcp-uhfffaoysa-m * smile...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHOSPHORYL-CHOLINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** phosphocholine |
| + | * molecular-weight: | ||
| + | ** 182.136 | ||
| + | * inchi-key: | ||
| + | ** yhhsonzfoiemcp-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c[n+](ccop([o-])([o-])=o)(c)c | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.7.7.15-RXN]] |
| − | * [[RXN- | + | * [[RXN-5647]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phosphocholine}} |
| + | {{#set: molecular-weight=182.136}} | ||
| + | {{#set: inchi-key=inchikey=yhhsonzfoiemcp-uhfffaoysa-m}} | ||
Revision as of 15:13, 15 March 2021
Contents
Metabolite PHOSPHORYL-CHOLINE
- common-name:
- phosphocholine
- molecular-weight:
- 182.136
- inchi-key:
- yhhsonzfoiemcp-uhfffaoysa-m
- smiles:
- c[n+](ccop([o-])([o-])=o)(c)c
