Difference between revisions of "Serines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Phospho-DNA-directed-RNA-polymerases == * common-name: ** phospho-[dna-directed rna-polymerase] == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite CPD-15318 == * common_name: ** α-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi_key: ** inchikey=k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15318 == |
| − | * | + | * common_name: |
| − | ** | + | ** α-d-ribose 5-phosphate |
| + | * smiles: | ||
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) | ||
| + | * inchi_key: | ||
| + | ** inchikey=ktvpxoyakdprhy-aihaylrmsa-l | ||
| + | * molecular_weight: | ||
| + | ** 228.095 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-14997]] |
| + | * [[RXN-15345]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=α-d-ribose 5-phosphate}} |
| + | {{#set: inchi_key=inchikey=ktvpxoyakdprhy-aihaylrmsa-l}} | ||
| + | {{#set: molecular_weight=228.095 }} | ||
Revision as of 18:59, 17 March 2021
Contents
Metabolite CPD-15318
- common_name:
- α-d-ribose 5-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
- inchi_key:
- inchikey=ktvpxoyakdprhy-aihaylrmsa-l
- molecular_weight:
- 228.095
