Difference between revisions of "ADP-D-Ribosyl-Acceptors"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-479 == * common-name: ** 4-(methylsulfanyl)-2-oxobutanoate * molecular-weight: ** 147.168 * inchi-key: ** sxfsqzdsuwackx-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite UDP-L-RHAMNOSE == * common-name: ** udp-β-l-rhamnose * molecular-weight: ** 548.29 * inchi-key: ** drdcjeizvlvwnc-slbwpepysa-l * smi...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-479 ==
+
== Metabolite UDP-L-RHAMNOSE ==
 
* common-name:
 
* common-name:
** 4-(methylsulfanyl)-2-oxobutanoate
+
** udp-β-l-rhamnose
 
* molecular-weight:
 
* molecular-weight:
** 147.168
+
** 548.29
 
* inchi-key:
 
* inchi-key:
** sxfsqzdsuwackx-uhfffaoysa-m
+
** drdcjeizvlvwnc-slbwpepysa-l
 
* smiles:
 
* smiles:
** csccc(c([o-])=o)=o
+
** cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12539]]
 
* [[RXN-14147]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R147-RXN]]
+
* [[RXN-5482]]
* [[RXN-14147]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(methylsulfanyl)-2-oxobutanoate}}
+
{{#set: common-name=udp-β-l-rhamnose}}
{{#set: molecular-weight=147.168}}
+
{{#set: molecular-weight=548.29}}
{{#set: inchi-key=inchikey=sxfsqzdsuwackx-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=drdcjeizvlvwnc-slbwpepysa-l}}

Revision as of 18:59, 17 March 2021

Metabolite UDP-L-RHAMNOSE

  • common-name:
    • udp-β-l-rhamnose
  • molecular-weight:
    • 548.29
  • inchi-key:
    • drdcjeizvlvwnc-slbwpepysa-l
  • smiles:
    • cc3(oc(op(op(=o)([o-])occ1(oc(c(o)c(o)1)n2(c=cc(=o)nc(=o)2)))([o-])=o)c(o)c(o)c(o)3)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality