Difference between revisions of "AMINO-HYDROXYMETHYL-METHYLPYRIMIDINE-PP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8999 == * common-name: ** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate * molecular-weight: ** 240.167 * inchi-key: ** hkeaovfnwrdva...")
(Created page with "Category:metabolite == Metabolite CPD-12173 == * common-name: ** (s)-3-hydroxy-isobutanoyl-coa * molecular-weight: ** 849.593 * inchi-key: ** wweogfzefhpuam-uqcjfraesa-j *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8999 ==
+
== Metabolite CPD-12173 ==
 
* common-name:
 
* common-name:
** 5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate
+
** (s)-3-hydroxy-isobutanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 240.167
+
** 849.593
 
* inchi-key:
 
* inchi-key:
** hkeaovfnwrdvaj-uhfffaoysa-l
+
** wweogfzefhpuam-uqcjfraesa-j
 
* smiles:
 
* smiles:
** csccc(=o)c(=o)cop([o-])(=o)[o-]
+
** cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.1.3.77-RXN]]
+
* [[3-HYDROXYISOBUTYRYL-COA-HYDROLASE-RXN]]
* [[R82-RXN]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[R145-RXN]]
+
* [[METHYLACYLYLCOA-HYDROXY-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-(methylsulfanyl)-2,3-dioxopentyl 1-phosphate}}
+
{{#set: common-name=(s)-3-hydroxy-isobutanoyl-coa}}
{{#set: molecular-weight=240.167}}
+
{{#set: molecular-weight=849.593}}
{{#set: inchi-key=inchikey=hkeaovfnwrdvaj-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=wweogfzefhpuam-uqcjfraesa-j}}

Revision as of 19:00, 17 March 2021

Metabolite CPD-12173

  • common-name:
    • (s)-3-hydroxy-isobutanoyl-coa
  • molecular-weight:
    • 849.593
  • inchi-key:
    • wweogfzefhpuam-uqcjfraesa-j
  • smiles:
    • cc(c(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])co

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality