Difference between revisions of "3-ENOLPYRUVYL-SHIKIMATE-5P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Histone-L-arginines == * common_name: ** [histone]-l-arginine == Reaction(s) known to consume the compound == * 2.1.1.125-RXN == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-17813 == * common-name: ** (2e,11z)-hexadec-2,11-dienoyl-coa * molecular-weight: ** 997.883 * inchi-key: ** amssmxhtrodksm-fyyfncousa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17813 == |
| − | * | + | * common-name: |
| − | ** [ | + | ** (2e,11z)-hexadec-2,11-dienoyl-coa |
| + | * molecular-weight: | ||
| + | ** 997.883 | ||
| + | * inchi-key: | ||
| + | ** amssmxhtrodksm-fyyfncousa-j | ||
| + | * smiles: | ||
| + | ** ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16558]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-16557]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=(2e,11z)-hexadec-2,11-dienoyl-coa}} |
| + | {{#set: molecular-weight=997.883}} | ||
| + | {{#set: inchi-key=inchikey=amssmxhtrodksm-fyyfncousa-j}} | ||
Revision as of 19:00, 17 March 2021
Contents
Metabolite CPD-17813
- common-name:
- (2e,11z)-hexadec-2,11-dienoyl-coa
- molecular-weight:
- 997.883
- inchi-key:
- amssmxhtrodksm-fyyfncousa-j
- smiles:
- ccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
