Difference between revisions of "MANNOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite FORMALDEHYDE == * common-name: ** formaldehyde * molecular-weight: ** 30.026 * inchi-key: ** wsfssnumvmoomr-uhfffaoysa-n * smiles: ** [ch...")
(Created page with "Category:metabolite == Metabolite CPD0-1163 == * common-name: ** (s)-3-hydroxy-(5z)-tetradecenoyl-coa * molecular-weight: ** 987.845 * inchi-key: ** kjjpuifalmaqpf-suakzgb...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite FORMALDEHYDE ==
+
== Metabolite CPD0-1163 ==
 
* common-name:
 
* common-name:
** formaldehyde
+
** (s)-3-hydroxy-(5z)-tetradecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 30.026
+
** 987.845
 
* inchi-key:
 
* inchi-key:
** wsfssnumvmoomr-uhfffaoysa-n
+
** kjjpuifalmaqpf-suakzgbesa-j
 
* smiles:
 
* smiles:
** [ch2]=o
+
** ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-2881]]
+
* [[RXN-14393]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13186]]
+
* [[RXN-14393]]
* [[RXN-14189]]
+
* [[RXN0-5393]]
* [[RXN-2961]]
 
* [[RXN-8660]]
 
* [[RXN-8661]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=formaldehyde}}
+
{{#set: common-name=(s)-3-hydroxy-(5z)-tetradecenoyl-coa}}
{{#set: molecular-weight=30.026}}
+
{{#set: molecular-weight=987.845}}
{{#set: inchi-key=inchikey=wsfssnumvmoomr-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=kjjpuifalmaqpf-suakzgbesa-j}}

Revision as of 19:00, 17 March 2021

Metabolite CPD0-1163

  • common-name:
    • (s)-3-hydroxy-(5z)-tetradecenoyl-coa
  • molecular-weight:
    • 987.845
  • inchi-key:
    • kjjpuifalmaqpf-suakzgbesa-j
  • smiles:
    • ccccccccc=ccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality