Difference between revisions of "Acyl-protein-synthetase"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite VAL-tRNAs == * common-name: ** a trnaval == Reaction(s) known to consume the compound == * VALINE--TRNA-LIGASE-RXN == Reaction(s) kno...") |
(Created page with "Category:metabolite == Metabolite LIOTHYRONINE == * common-name: ** 3,5,3'-triiodo-l-thyronine * molecular-weight: ** 650.978 * inchi-key: ** auyycjsjgjycds-lbprgkrzsa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LIOTHYRONINE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3,5,3'-triiodo-l-thyronine |
+ | * molecular-weight: | ||
+ | ** 650.978 | ||
+ | * inchi-key: | ||
+ | ** auyycjsjgjycds-lbprgkrzsa-n | ||
+ | * smiles: | ||
+ | ** c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-])) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-10607]] |
+ | * [[RXN-10609]] | ||
+ | * [[RXN-10615]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3,5,3'-triiodo-l-thyronine}} |
+ | {{#set: molecular-weight=650.978}} | ||
+ | {{#set: inchi-key=inchikey=auyycjsjgjycds-lbprgkrzsa-n}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite LIOTHYRONINE
- common-name:
- 3,5,3'-triiodo-l-thyronine
- molecular-weight:
- 650.978
- inchi-key:
- auyycjsjgjycds-lbprgkrzsa-n
- smiles:
- c1(c=c(o)c(i)=cc=1oc2(=c(i)c=c(c=c(i)2)cc([n+])c(=o)[o-]))