Difference between revisions of "THF-GLU-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-Methionylaminoacyl-tRNAs == * common-name: ** a l-methionylaminoacyl-trna == Reaction(s) known to consume the compound == == Reaction(s...") |
(Created page with "Category:metabolite == Metabolite CPD-15436 == * common-name: ** (5z)-tetradecenoyl-coa * molecular-weight: ** 971.845 * inchi-key: ** mrvdzohjmltlhj-stfckwfxsa-j * smiles...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15436 == |
* common-name: | * common-name: | ||
− | ** | + | ** (5z)-tetradecenoyl-coa |
+ | * molecular-weight: | ||
+ | ** 971.845 | ||
+ | * inchi-key: | ||
+ | ** mrvdzohjmltlhj-stfckwfxsa-j | ||
+ | * smiles: | ||
+ | ** ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-14576]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-17782]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(5z)-tetradecenoyl-coa}} |
+ | {{#set: molecular-weight=971.845}} | ||
+ | {{#set: inchi-key=inchikey=mrvdzohjmltlhj-stfckwfxsa-j}} |
Revision as of 19:00, 17 March 2021
Contents
Metabolite CPD-15436
- common-name:
- (5z)-tetradecenoyl-coa
- molecular-weight:
- 971.845
- inchi-key:
- mrvdzohjmltlhj-stfckwfxsa-j
- smiles:
- ccccccccc=ccccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o