Difference between revisions of "5-METHYLTHIOADENOSINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYADENOSINE == * common-name: ** 2'-deoxyadenosine * molecular-weight: ** 251.244 * inchi-key: ** olxzpdwkrnyjjz-rrkcrqdmsa-n * smiles...")
(Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * molecular-weight: ** 106.124 * inchi-key: ** humnylrzrppjdn-uhfffaoysa-n * smiles: ** c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEOXYADENOSINE ==
+
== Metabolite BENZALDEHYDE ==
 
* common-name:
 
* common-name:
** 2'-deoxyadenosine
+
** benzaldehyde
 
* molecular-weight:
 
* molecular-weight:
** 251.244
+
** 106.124
 
* inchi-key:
 
* inchi-key:
** olxzpdwkrnyjjz-rrkcrqdmsa-n
+
** humnylrzrppjdn-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(o)c1(oc(cc(o)1)n3(c=nc2(=c(n)n=cn=c23)))
+
** c(=o)c1(=cc=cc=c1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADDALT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PHENYLSERINE-ALDOLASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyadenosine}}
+
{{#set: common-name=benzaldehyde}}
{{#set: molecular-weight=251.244}}
+
{{#set: molecular-weight=106.124}}
{{#set: inchi-key=inchikey=olxzpdwkrnyjjz-rrkcrqdmsa-n}}
+
{{#set: inchi-key=inchikey=humnylrzrppjdn-uhfffaoysa-n}}

Revision as of 19:01, 17 March 2021

Metabolite BENZALDEHYDE

  • common-name:
    • benzaldehyde
  • molecular-weight:
    • 106.124
  • inchi-key:
    • humnylrzrppjdn-uhfffaoysa-n
  • smiles:
    • c(=o)c1(=cc=cc=c1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality