Difference between revisions of "CPD-14425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19148 == * common-name: ** (5z)-dodecenoyl-coa * molecular-weight: ** 943.792 * inchi-key: ** rcvjzgbrlgutkt-cggpsvllsa-j * smiles: *...")
(Created page with "Category:metabolite == Metabolite Long-linear-glucans == * common-name: ** a long-linear α-d-glucan == Reaction(s) known to consume the compound == * RXN-1826 ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19148 ==
+
== Metabolite Long-linear-glucans ==
 
* common-name:
 
* common-name:
** (5z)-dodecenoyl-coa
+
** a long-linear α-d-glucan
* molecular-weight:
 
** 943.792
 
* inchi-key:
 
** rcvjzgbrlgutkt-cggpsvllsa-j
 
* smiles:
 
** ccccccc=ccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-1826]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17795]]
+
* [[RXN-1826]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z)-dodecenoyl-coa}}
+
{{#set: common-name=a long-linear α-d-glucan}}
{{#set: molecular-weight=943.792}}
 
{{#set: inchi-key=inchikey=rcvjzgbrlgutkt-cggpsvllsa-j}}
 

Revision as of 19:02, 17 March 2021

Metabolite Long-linear-glucans

  • common-name:
    • a long-linear α-d-glucan

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality