Difference between revisions of "3-Oxo-octanoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GDP-4-DEHYDRO-6-DEOXY-D-MANNOSE == * common-name: ** gdp-4-dehydro-α-d-rhamnose * molecular-weight: ** 585.314 * inchi-key: ** pnhl...") |
(Created page with "Category:metabolite == Metabolite MALTOTETRAOSE == * common-name: ** maltotetraose * molecular-weight: ** 666.583 * inchi-key: ** luewuzlmquobsb-ayqjavfrsa-n * smiles: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite MALTOTETRAOSE == |
* common-name: | * common-name: | ||
− | ** | + | ** maltotetraose |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 666.583 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** luewuzlmquobsb-ayqjavfrsa-n |
* smiles: | * smiles: | ||
− | ** | + | ** c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN0-5182]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GLYMALTOPHOSPHORYL-RXN]] |
+ | * [[RXN-14284]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=maltotetraose}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=666.583}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=luewuzlmquobsb-ayqjavfrsa-n}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite MALTOTETRAOSE
- common-name:
- maltotetraose
- molecular-weight:
- 666.583
- inchi-key:
- luewuzlmquobsb-ayqjavfrsa-n
- smiles:
- c(c4(oc(oc3(c(oc(oc2(c(oc(oc1(c(oc(o)c(c1o)o)co))c(c2o)o)co))c(c3o)o)co))c(c(o)c4o)o))o