Difference between revisions of "ACYL-SN-GLYCEROL-3P"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11878 == * common-name: ** 3,4-dihydroxyphenylglycol * molecular-weight: ** 170.165 * inchi-key: ** mtvwfvdwrvydor-qmmmgpobsa-n * smi...") |
(Created page with "Category:metabolite == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == * common-name: ** luteolin 7-o-β-d-diglucuronide * molecular-weight: ** 636.476 * inchi-key: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE == |
* common-name: | * common-name: | ||
− | ** | + | ** luteolin 7-o-β-d-diglucuronide |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 636.476 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pbbvwjqpazyqdb-dbfweqbmsa-l |
* smiles: | * smiles: | ||
− | ** c(o)c( | + | ** c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-15288]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=luteolin 7-o-β-d-diglucuronide}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=636.476}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pbbvwjqpazyqdb-dbfweqbmsa-l}} |
Revision as of 19:02, 17 March 2021
Contents
Metabolite LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE
- common-name:
- luteolin 7-o-β-d-diglucuronide
- molecular-weight:
- 636.476
- inchi-key:
- pbbvwjqpazyqdb-dbfweqbmsa-l
- smiles:
- c(c5(oc(oc1(c(c(c(c([o-])=o)oc1oc4(c=c3(c(c(c=c(c2(=cc=c(c(=c2)o)o))o3)=o)=c(c=4)o)))o)o))c(c(c5o)o)o))([o-])=o