Difference between revisions of "2E-11Z-icosa-2-11-dienoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-CYSTEATE == * common-name: ** l-cysteate * molecular-weight: ** 168.144 * inchi-key: ** xvoyscvbglvsol-reohclbhsa-m * smiles: ** c(c([n...")
(Created page with "Category:metabolite == Metabolite MALEAMATE == * common-name: ** maleamate * molecular-weight: ** 114.08 * inchi-key: ** fsqqtnazhbejls-uphrsurjsa-m * smiles: ** c(=cc(=o)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-CYSTEATE ==
+
== Metabolite MALEAMATE ==
 
* common-name:
 
* common-name:
** l-cysteate
+
** maleamate
 
* molecular-weight:
 
* molecular-weight:
** 168.144
+
** 114.08
 
* inchi-key:
 
* inchi-key:
** xvoyscvbglvsol-reohclbhsa-m
+
** fsqqtnazhbejls-uphrsurjsa-m
 
* smiles:
 
* smiles:
** c(c([n+])c(=o)[o-])s(=o)(=o)[o-]
+
** c(=cc(=o)[o-])c(n)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11737]]
+
* [[RXN-646]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11737]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-cysteate}}
+
{{#set: common-name=maleamate}}
{{#set: molecular-weight=168.144}}
+
{{#set: molecular-weight=114.08}}
{{#set: inchi-key=inchikey=xvoyscvbglvsol-reohclbhsa-m}}
+
{{#set: inchi-key=inchikey=fsqqtnazhbejls-uphrsurjsa-m}}

Revision as of 19:02, 17 March 2021

Metabolite MALEAMATE

  • common-name:
    • maleamate
  • molecular-weight:
    • 114.08
  • inchi-key:
    • fsqqtnazhbejls-uphrsurjsa-m
  • smiles:
    • c(=cc(=o)[o-])c(n)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality